PHAT
7-(Propylamino)-5,6,7,8-tetrahydronaphthalen-1-ol
 6959 C13H19NO 205.296
 InChI=1S/C13H19NO/c1-2-8-14-11-7-6-10-4-3-5-13(15)12(10)9-11/h3-5,11,14-15H,2,6-9H2,1H3
 PNYMUTZDLKGATA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNC1CCc2c(C1)c(O)ccc2