EEAT
7-(Diethylamino)-5,6,7,8-tetrahydronaphthalen-1-ol
 6958 C14H21NO 219.323
 InChI=1S/C14H21NO/c1-3-15(4-2)12-9-8-11-6-5-7-14(16)13(11)10-12/h5-7,12,16H,3-4,8-10H2,1-2H3
 KELVYHRCPWEBTF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C1CCc2c(C1)c(O)ccc2)CC