EHAT
7-(Ethylamino)-5,6,7,8-tetrahydronaphthalen-1-ol
 6957 C12H17NO 191.269
 InChI=1S/C12H17NO/c1-2-13-10-7-6-9-4-3-5-12(14)11(9)8-10/h3-5,10,13-14H,2,6-8H2,1H3
 DTLFTJICCITUGW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC1CCc2c(C1)c(O)ccc2