MHAT
7-(Methylamino)-5,6,7,8-tetrahydronaphthalen-1-ol
 6955 C11H15NO 177.243
 InChI=1S/C11H15NO/c1-12-9-6-5-8-3-2-4-11(13)10(8)7-9/h2-4,9,12-13H,5-7H2,1H3
 RKQNQEQRWHOAOX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC1CCc2c(C1)c(O)ccc2