HHAT
7-Amino-5,6,7,8-tetrahydronaphthalen-1-ol
 6954 C10H13NO 163.216
 InChI=1S/C10H13NO/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h1-3,8,12H,4-6,11H2
 XFVYVTYPFIERLX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NC1CCc2c(C1)c(O)ccc2