2,6-DCA
1-(2,6-Dichlorophenyl)propan-2-amine
 6952 C9H11Cl2N 204.096
 InChI=1S/C9H11Cl2N/c1-6(12)5-7-8(10)3-2-4-9(7)11/h2-4,6H,5,12H2,1H3
 FAYVXOYNOTWBLV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c(Cl)cccc1Cl)N