4C-3,5-DMPEA
1-(3,5-Dimethylphenyl)butan-2-amine
 6951 C12H19N 177.286
 InChI=1S/C12H19N/c1-4-12(13)8-11-6-9(2)5-10(3)7-11/h5-7,12H,4,8,13H2,1-3H3
 LBMKWWSZDFMUPS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1cc(C)cc(c1)C)N