AD-1211
3-{2-[4-(3-Methylbut-2-en-1-yl)piperazin-1-yl]-2-phenylethyl}phenol
 694 C23H30N2O 350.497
 InChI=1S/C23H30N2O/c1-19(2)11-12-24-13-15-25(16-14-24)23(21-8-4-3-5-9-21)18-20-7-6-10-22(26)17-20/h3-11,17,23,26H,12-16,18H2,1-2H3
 WLHCNEPBQJOHKW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(=CCN1CCN(CC1)C(c1ccccc1)Cc1cccc(c1)O)C