3,5-HMPEA
3-(2-Aminoethyl)-5-methoxyphenol
 6921 C9H13NO2 167.205
 InChI=1S/C9H13NO2/c1-12-9-5-7(2-3-10)4-8(11)6-9/h4-6,11H,2-3,10H2,1H3
 RXNRGKVNJZPZNO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)cc(c1)O