β,2-HO-N-Me-5-EA
4-Ethoxy-2-[1-hydroxy-2-(methylamino)propyl]phenol
 6910 C12H19NO3 225.284
 InChI=1S/C12H19NO3/c1-4-16-9-5-6-11(14)10(7-9)12(15)8(2)13-3/h5-8,12-15H,4H2,1-3H3
 VZNJLAGGAFRCGE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1ccc(c(c1)C(C(NC)C)O)O