β,N,N-Me-2,5-DMPEA
2-(2,5-Dimethoxyphenyl)-N,N-dimethylpropan-1-amine
 6862 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-10(9-14(2)3)12-8-11(15-4)6-7-13(12)16-5/h6-8,10H,9H2,1-5H3
 KSDXRSSSRLDPKP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1C(CN(C)C)C)OC