2,5-HMPEA
2-(2-Aminoethyl)-4-methoxyphenol
 6829 C9H13NO2 167.205
 InChI=1S/C9H13NO2/c1-12-8-2-3-9(11)7(6-8)4-5-10/h2-3,6,11H,4-5,10H2,1H3
 WDAATBIZVHOPMI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)ccc1O