β-HO-2-M-5-MeA
2-Amino-1-(2-methoxy-5-methylphenyl)propan-1-ol
 6820 C11H17NO2 195.258
 InChI=1S/C11H17NO2/c1-7-4-5-10(14-3)9(6-7)11(13)8(2)12/h4-6,8,11,13H,12H2,1-3H3
 TZOQRNSNVWMTCO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(cc1C(C(N)C)O)C