3,4-Me-NEB
1-(3,4-Dimethylphenyl)-2-(ethylamino)butan-1-one
 682 C14H21NO 219.323
 InChI=1S/C14H21NO/c1-5-13(15-6-2)14(16)12-8-7-10(3)11(4)9-12/h7-9,13,15H,5-6H2,1-4H3
 RUVHFAHTBYMIBG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(C(=O)c1ccc(c(c1)C)C)CC