β,2-HO-5-MePEA
2-(2-Amino-1-hydroxyethyl)-4-methylphenol
 6812 C9H13NO2 167.205
 InChI=1S/C9H13NO2/c1-6-2-3-8(11)7(4-6)9(12)5-10/h2-4,9,11-12H,5,10H2,1H3
 FVKJGRYPUPIZID-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1cc(C)ccc1O)O