4-iBu-2,5-DMBAL
2,5-Dimethoxy-4-(2-methylpropyl)benzaldehyde
 6761  C13H18O3  222.28
 InChI=1S/C13H18O3/c1-9(2)5-10-6-13(16-4)11(8-14)7-12(10)15-3/h6-9H,5H2,1-4H3
 PKDYEPBTNRRUJK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C=O)c(cc1CC(C)C)OC