α-HO-DET
1-(Diethylamino)-2-(1H-indol-3-yl)ethan-1-ol
 6750  C14H20N2O  232.321
 InChI=1S/C14H20N2O/c1-3-16(4-2)14(17)9-11-10-15-13-8-6-5-7-12(11)13/h5-8,10,14-15,17H,3-4,9H2,1-2H3
 LFHUEGFWDOXVAT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C(Cc1c[nH]c2c1cccc2)O)CC