α-HO-pip-T
2-(1H-Indol-3-yl)-1-(pyrrolidin-1-yl)ethan-1-ol
 6748  C14H18N2O  230.306
 InChI=1S/C14H18N2O/c17-14(16-7-3-4-8-16)9-11-10-15-13-6-2-1-5-12(11)13/h1-2,5-6,10,14-15,17H,3-4,7-9H2
 NWCSVVZFBVJENB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 OC(N1CCCC1)Cc1c[nH]c2c1cccc2