N,N-Me-DEPEA
2-(3,4-Diethoxyphenyl)-N,N-dimethylethan-1-amine
 6654 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-5-16-13-8-7-12(9-10-15(3)4)11-14(13)17-6-2/h7-8,11H,5-6,9-10H2,1-4H3
 CBDBYEXITFAZJI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(CCN(C)C)ccc1OCC