N-Me-DEPEA
2-(3,4-Diethoxyphenyl)-N-methylethan-1-amine
 6653 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-4-15-12-7-6-11(8-9-14-3)10-13(12)16-5-2/h6-7,10,14H,4-5,8-9H2,1-3H3
 GIGVGCGULYWMRH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1ccc(c(c1)OCC)OCC