DEPEA
2-(3,4-Diethoxyphenyl)ethan-1-amine
 6652 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-3-14-11-6-5-10(7-8-13)9-12(11)15-4-2/h5-6,9H,3-4,7-8,13H2,1-2H3
 YOUNXJAJHCCMNK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(c(c1)OCC)OCC