2,2-DEPy
1-(2,2-Diphenylethyl)pyrrolidine
 665 C18H21N 251.366
 InChI=1S/C18H21N/c1-3-9-16(10-4-1)18(15-19-13-7-8-14-19)17-11-5-2-6-12-17/h1-6,9-12,18H,7-8,13-15H2
 SEDBCUFZVPCLRK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C1CCN(C1)CC(c1ccccc1)c1ccccc1