IDDC
10,11-Dihydro-5H-10,5-(epiminomethano)dibenzo[a,d][7]annulene
 6636 C16H15N 221.297
 Arylcycloalkylamine
 InChI=1S/C16H15N/c1-2-6-12-11(5-1)9-16-14-8-4-3-7-13(14)15(12)10-17-16/h1-8,15-17H,9-10H2
 HWPDIGZXZMCJHZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 c1ccc2c(c1)C1CNC(C2)c2c1cccc2