EMA
1-(3-Ethoxy-4-methoxyphenyl)propan-2-amine
 6631 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-4-15-12-8-10(7-9(2)13)5-6-11(12)14-3/h5-6,8-9H,4,7,13H2,1-3H3
 MWQIQYJDMMQYID-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(ccc1OC)CC(N)C