N-Me-EMPEA
2-(3-Ethoxy-4-methoxyphenyl)-N-methylethan-1-amine
 6629 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-4-15-12-9-10(7-8-13-2)5-6-11(12)14-3/h5-6,9,13H,4,7-8H2,1-3H3
 LWKQZEOXWANJKZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1ccc(c(c1)OCC)OC