1-(3,4-Dimethoxyphenyl)-N-ethylpropan-2-amine
 6622 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-14-10(2)8-11-6-7-12(15-3)13(9-11)16-4/h6-7,9-10,14H,5,8H2,1-4H3
 ZRXZDUBEZXLNLM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1ccc(c(c1)OC)OC)C