N-Et-DMPEA
2-(3,4-Dimethoxyphenyl)-N-ethylethan-1-amine
 6616 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-4-13-8-7-10-5-6-11(14-2)12(9-10)15-3/h5-6,9,13H,4,7-8H2,1-3H3
 HRNUZLNPJAFQML-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCCc1ccc(c(c1)OC)OC