N-Me,CHO-DME
N-[2-(3,4-Dimethoxyphenyl)-2-hydroxyethyl]-N-methylformamide
 6609 C12H17NO4 239.268
 InChI=1S/C12H17NO4/c1-13(8-14)7-10(15)9-4-5-11(16-2)12(6-9)17-3/h4-6,8,10,15H,7H2,1-3H3
 NXXDQJNZPLEMAI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=CN(CC(c1ccc(c(c1)OC)OC)O)C