N-Me-α-Et-GEA
2-Methoxy-4-[2-(methylamino)butyl]phenol
 6569 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-4-10(13-2)7-9-5-6-11(14)12(8-9)15-3/h5-6,8,10,13-14H,4,7H2,1-3H3
 ZTWKZEBPMKVVOM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1ccc(c(c1)OC)O)NC