DHEA
4-[2-(Ethylamino)propyl]benzene-1,2-diol
 6534 C11H17NO2 195.258
 InChI=1S/C11H17NO2/c1-3-12-8(2)6-9-4-5-10(13)11(14)7-9/h4-5,7-8,12-14H,3,6H2,1-2H3
 CKUGRMSDBDIJRN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNC(Cc1ccc(c(c1)O)O)C