N,N-Me-DHA
4-[2-(Dimethylamino)propyl]benzene-1,2-diol
 6530 C11H17NO2 195.258
 InChI=1S/C11H17NO2/c1-8(12(2)3)6-9-4-5-10(13)11(14)7-9/h4-5,7-8,13-14H,6H2,1-3H3
 IGATVIFAMZLMSA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C(Cc1ccc(c(c1)O)O)C)C