N-iBu-DHPEA
4-{2-[(2-Methylpropyl)amino]ethyl}benzene-1,2-diol
 6516 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-9(2)8-13-6-5-10-3-4-11(14)12(15)7-10/h3-4,7,9,13-15H,5-6,8H2,1-2H3
 FHHLWPFWXLHGBF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(CNCCc1ccc(c(c1)O)O)C