N-Et-DHPEA
4-[2-(Ethylamino)ethyl]benzene-1,2-diol
 6514 C10H15NO2 181.232
 InChI=1S/C10H15NO2/c1-2-11-6-5-8-3-4-9(12)10(13)7-8/h3-4,7,11-13H,2,5-6H2,1H3
 ZRNSCURSJJRPGN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCNCCc1ccc(c(c1)O)O