N-Me-DMeA
1-(3,4-Dimethylphenyl)-N-methylpropan-2-amine
 6486 C12H19N 177.286
 InChI=1S/C12H19N/c1-9-5-6-12(7-10(9)2)8-11(3)13-4/h5-7,11,13H,8H2,1-4H3
 PVWHDNKDZPUSGJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(Cc1ccc(c(c1)C)C)C