N-{1-Oxo-5-[(2-phenylethyl)amino]pentan-3-yl}-N-phenylpropanamide
 6474 C22H28N2O2 352.47
 InChI=1S/C22H28N2O2/c1-2-22(26)24(20-11-7-4-8-12-20)21(15-18-25)14-17-23-16-13-19-9-5-3-6-10-19/h3-12,18,21,23H,2,13-17H2,1H3
 MAVSOEWNXLHYCG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=CCC(N(c1ccccc1)C(=O)CC)CCNCCc1ccccc1