2,4-EMPEA
2-(2-Ethoxy-4-methoxyphenyl)ethan-1-amine
 6466 C11H17NO2 195.258
 InChI=1S/C11H17NO2/c1-3-14-11-8-10(13-2)5-4-9(11)6-7-12/h4-5,8H,3,6-7,12H2,1-2H3
 QAXUKBWYVGIBRW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1ccc(cc1OCC)OC