2,4-DMA-βk
2-Amino-1-(2,4-dimethoxyphenyl)propan-1-one
 6462 C11H15NO3 209.242
 InChI=1S/C11H15NO3/c1-7(12)11(13)9-5-4-8(14-2)6-10(9)15-3/h4-7H,12H2,1-3H3
 RFHRDZSOSYEDHE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OC)ccc1C(=O)C(N)C