6-Methylbaeocystin
6-Methyl-3-[2-(methylamino)ethyl]-1H-indol-4-yl dihydrogen phosphate
 6448  C12H17N2O4P  284.248
 InChI=1S/C12H17N2O4P/c1-8-5-10-12(9(7-14-10)3-4-13-2)11(6-8)18-19(15,16)17/h5-7,13-14H,3-4H2,1-2H3,(H2,15,16,17)
 DUQYMHSRRPFILO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1c[nH]c2c1c(cc(c2)C)OP(=O)(O)O