Tolibut
4-Amino-3-(4-methylphenyl)butanoic acid
 640 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-8-2-4-9(5-3-8)10(7-12)6-11(13)14/h2-5,10H,6-7,12H2,1H3,(H,13,14)
 MSZRPURXKHMSFF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1ccc(cc1)C)CC(=O)O