4″-BzO-TCP
1-[1-(Thiophen-2-yl)cyclohexyl]piperidin-4-yl benzoate
 6391 C22H27NO2S 369.52
 Arylcycloalkylamine
 InChI=1S/C22H27NO2S/c24-21(18-8-3-1-4-9-18)25-19-11-15-23(16-12-19)22(13-5-2-6-14-22)20-10-7-17-26-20/h1,3-4,7-10,17,19H,2,5-6,11-16H2
 BTHQARZRVRAOTG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(c1ccccc1)OC1CCN(CC1)C1(CCCCC1)c1cccs1