SL-164
5-Chloro-3-(4-chloro-2-methylphenyl)-2-methylquinazolin-4(3H)-one
 6382 C16H12Cl2N2O 319.185
 InChI=1S/C16H12Cl2N2O/c1-9-8-11(17)6-7-14(9)20-10(2)19-13-5-3-4-12(18)15(13)16(20)21/h3-8H,1-2H3
 KUIHLOHNUGOCTO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Clc1ccc(c(c1)C)n1c(C)nc2c(c1=O)c(Cl)ccc2