N,N-Me-DMPEA-2
2-(2,3-Dimethoxyphenyl)-N,N-dimethylethan-1-amine
 6379 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-13(2)9-8-10-6-5-7-11(14-3)12(10)15-4/h5-7H,8-9H2,1-4H3
 CMUIIRZOUBGDFW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(cccc1OC)CCN(C)C