2,3-HMPEA
2-(2-Aminoethyl)-6-methoxyphenol
 6376 C9H13NO2 167.205
 InChI=1S/C9H13NO2/c1-12-8-4-2-3-7(5-6-10)9(8)11/h2-4,11H,5-6,10H2,1H3
 QKCSVOQSBJXICK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cccc(c1O)OC