2,3-HMeMPEA
2-Methyl-6-[2-(methylamino)ethyl]phenol
 6364 C10H15NO 165.232
 InChI=1S/C10H15NO/c1-8-4-3-5-9(10(8)12)6-7-11-2/h3-5,11-12H,6-7H2,1-2H3
 HTSMXNONBVHBQA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCc1cccc(c1O)C