2,3-HMePEA
2-(2-Aminoethyl)-6-methylphenol
 6363 C9H13NO 151.206
 InChI=1S/C9H13NO/c1-7-3-2-4-8(5-6-10)9(7)11/h2-4,11H,5-6,10H2,1H3
 JVPHBVRBYDPJRX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1cccc(c1O)CCN