4-BzA
1-[4-(Benzyloxy)phenyl]propan-2-amine
 6335  C16H19NO  241.328
 InChI=1S/C16H19NO/c1-13(17)11-14-7-9-16(10-8-14)18-12-15-5-3-2-4-6-15/h2-10,13H,11-12,17H2,1H3
 ZDZASCUBDMUTSR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1)OCc1ccccc1)N