PPhA
1-(4-Phenoxyphenyl)propan-2-amine
 6334  C15H17NO  227.302
 InChI=1S/C15H17NO/c1-12(16)11-13-7-9-15(10-8-13)17-14-5-3-2-4-6-14/h2-10,12H,11,16H2,1H3
 PBKHSMOCTJGLGT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccc(cc1)Oc1ccccc1)N