4-NPEA
2-[4-(Nonyloxy)phenyl]ethan-1-amine
 6332  C17H29NO  263.418
 InChI=1S/C17H29NO/c1-2-3-4-5-6-7-8-15-19-17-11-9-16(10-12-17)13-14-18/h9-12H,2-8,13-15,18H2,1H3
 DIHWWIBNEQVRDK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCCCCOc1ccc(cc1)CCN