4-APEA
2-[4-(Pentyloxy)phenyl]ethan-1-amine
 6328  C13H21NO  207.312
 InChI=1S/C13H21NO/c1-2-3-4-11-15-13-7-5-12(6-8-13)9-10-14/h5-8H,2-4,9-11,14H2,1H3
 ZVKHXKDWBUFMFI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCOc1ccc(cc1)CCN