4-BPEA
2-(4-Butoxyphenyl)ethan-1-amine
 6327 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-2-3-10-14-12-6-4-11(5-7-12)8-9-13/h4-7H,2-3,8-10,13H2,1H3
 OIOGOZZYBQRPLA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCOc1ccc(cc1)CCN